C32H32O7 — CID 122679907
(4aS,5R,5aS,6E,12aR)-2-acetyl-10,11,12a-trihydroxy-6-[(4-methoxyphenyl)methylidene]-3,4a,5,5a-tetramethyl-4,5-dihydrotetracene-1,12-dione (PubChem CID 122679907) has the molecular formula C32H32O7 and a molecular weight of 528.60 g/mol. Its IUPAC name is (4aS,5R,5aS,6E,12aR)-2-acetyl-10,11,12a-trihydroxy-6-[(4-methoxyphenyl)methylidene]-3,4a,5,5a-tetramethyl-4,5-dihydrotetracene-1,12-dione.
| Compound Name | (4aS,5R,5aS,6E,12aR)-2-acetyl-10,11,12a-trihydroxy-6-[(4-methoxyphenyl)methylidene]-3,4a,5,5a-tetramethyl-4,5-dihydrotetracene-1,12-dione |
|---|---|
| PubChem CID | 122679907 |
| Molecular Formula | C32H32O7 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | (4aS,5R,5aS,6E,12aR)-2-acetyl-10,11,12a-trihydroxy-6-[(4-methoxyphenyl)methylidene]-3,4a,5,5a-tetramethyl-4,5-dihydrotetracene-1,12-dione |
| SMILES | COc1ccc(/C=C2\c3cccc(O)c3C(O)=C3C(=O)[C@@]4(O)C(=O)C(C(C)=O)=C(C)C[C@@]4(C)[C@H](C)[C@]32C)cc1 |
| InChI | InChI=1S/C32H32O7/c1-16-15-30(4)18(3)31(5)22(14-19-10-12-20(39-6)13-11-19)21-8-7-9-23(34)25(21)27(35)26(31)29(37)32(30,38)28(36)24(16)17(2)33/h7-14,18,34-35,38H,15H2,1-6H3/b22-14+/t18-,30-,31-,32-/m0/s1 |
| InChIKey | IWTVVXMZKDEGHB-FCZSDLKUSA-N |
| XLogP | 5.06 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|