C29H34O6 — CID 122679887
(4aS,5R,5aR,6R,12aR)-2-acetyl-10,11,12a-trihydroxy-3,4a,5a,6-tetramethyl-5-(2-methylidenebutyl)-5,6-dihydro-4H-tetracene-1,12-dione (PubChem CID 122679887) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is (4aS,5R,5aR,6R,12aR)-2-acetyl-10,11,12a-trihydroxy-3,4a,5a,6-tetramethyl-5-(2-methylidenebutyl)-5,6-dihydro-4H-tetracene-1,12-dione.
| Compound Name | (4aS,5R,5aR,6R,12aR)-2-acetyl-10,11,12a-trihydroxy-3,4a,5a,6-tetramethyl-5-(2-methylidenebutyl)-5,6-dihydro-4H-tetracene-1,12-dione |
|---|---|
| PubChem CID | 122679887 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (4aS,5R,5aR,6R,12aR)-2-acetyl-10,11,12a-trihydroxy-3,4a,5a,6-tetramethyl-5-(2-methylidenebutyl)-5,6-dihydro-4H-tetracene-1,12-dione |
| SMILES | C=C(CC)C[C@@H]1[C@]2(C)C(=C(O)c3c(O)cccc3[C@H]2C)C(=O)[C@@]2(O)C(=O)C(C(C)=O)=C(C)C[C@@]12C |
| InChI | InChI=1S/C29H34O6/c1-8-14(2)12-20-27(6)13-15(3)21(17(5)30)25(33)29(27,35)26(34)23-24(32)22-18(10-9-11-19(22)31)16(4)28(20,23)7/h9-11,16,20,31-32,35H,2,8,12-13H2,1,3-7H3/t16-,20+,27+,28-,29+/m1/s1 |
| InChIKey | DZNAKJSICAZBCB-XGIWHONRSA-N |
| XLogP | 4.96 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|