C26H28O6 — CID 122680442
(4aS,5aR,12aR)-2-acetyl-10,11,12a-trihydroxy-3,4a,5a-trimethyl-7-prop-1-en-2-yl-5,6-dihydro-4H-tetracene-1,12-dione (PubChem CID 122680442) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is (4aS,5aR,12aR)-2-acetyl-10,11,12a-trihydroxy-3,4a,5a-trimethyl-7-prop-1-en-2-yl-5,6-dihydro-4H-tetracene-1,12-dione.
| Compound Name | (4aS,5aR,12aR)-2-acetyl-10,11,12a-trihydroxy-3,4a,5a-trimethyl-7-prop-1-en-2-yl-5,6-dihydro-4H-tetracene-1,12-dione |
|---|---|
| PubChem CID | 122680442 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (4aS,5aR,12aR)-2-acetyl-10,11,12a-trihydroxy-3,4a,5a-trimethyl-7-prop-1-en-2-yl-5,6-dihydro-4H-tetracene-1,12-dione |
| SMILES | C=C(C)c1ccc(O)c2c1C[C@]1(C)C[C@]3(C)CC(C)=C(C(C)=O)C(=O)[C@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C26H28O6/c1-12(2)15-7-8-17(28)19-16(15)10-24(5)11-25(6)9-13(3)18(14(4)27)22(30)26(25,32)23(31)20(24)21(19)29/h7-8,28-29,32H,1,9-11H2,2-6H3/t24-,25+,26+/m1/s1 |
| InChIKey | HLTRSJAXGMZCRY-ZNZIZOMTSA-N |
| XLogP | 3.85 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|