C22H14Cl2O2 — CID 46855479
1,8-dichloro-10-[(4-methoxyphenyl)methylidene]anthracen-9-one (PubChem CID 46855479) has the molecular formula C22H14Cl2O2 and a molecular weight of 381.26 g/mol. Its IUPAC name is 1,8-dichloro-10-[(4-methoxyphenyl)methylidene]anthracen-9-one.
| Compound Name | 1,8-dichloro-10-[(4-methoxyphenyl)methylidene]anthracen-9-one |
|---|---|
| PubChem CID | 46855479 |
| Molecular Formula | C22H14Cl2O2 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 1,8-dichloro-10-[(4-methoxyphenyl)methylidene]anthracen-9-one |
| SMILES | COc1ccc(C=C2c3cccc(Cl)c3C(=O)c3c(Cl)cccc32)cc1 |
| InChI | InChI=1S/C22H14Cl2O2/c1-26-14-10-8-13(9-11-14)12-17-15-4-2-6-18(23)20(15)22(25)21-16(17)5-3-7-19(21)24/h2-12H,1H3 |
| InChIKey | GTPOBNVRQIXKDJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|