C23H14Cl2O3 — CID 46854073
(10E)-1,5-dichloro-10-[2-(4-methoxyphenyl)-2-oxoethylidene]anthracen-9-one (PubChem CID 46854073) has the molecular formula C23H14Cl2O3 and a molecular weight of 409.27 g/mol. Its IUPAC name is (10E)-1,5-dichloro-10-[2-(4-methoxyphenyl)-2-oxoethylidene]anthracen-9-one.
| Compound Name | (10E)-1,5-dichloro-10-[2-(4-methoxyphenyl)-2-oxoethylidene]anthracen-9-one |
|---|---|
| PubChem CID | 46854073 |
| Molecular Formula | C23H14Cl2O3 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | (10E)-1,5-dichloro-10-[2-(4-methoxyphenyl)-2-oxoethylidene]anthracen-9-one |
| SMILES | COc1ccc(C(=O)/C=C2\c3cccc(Cl)c3C(=O)c3cccc(Cl)c32)cc1 |
| InChI | InChI=1S/C23H14Cl2O3/c1-28-14-10-8-13(9-11-14)20(26)12-17-15-4-2-7-19(25)22(15)23(27)16-5-3-6-18(24)21(16)17/h2-12H,1H3/b17-12+ |
| InChIKey | HSPLIRJCAUSDPX-SFQUDFHCSA-N |
| XLogP | 5.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|