C29H25N3O8 — CID 91372977
(4R,4aS,5R,5aR,12aR)-6-[(4-cyanophenyl)methylidene]-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91372977) has the molecular formula C29H25N3O8 and a molecular weight of 543.53 g/mol. Its IUPAC name is (4R,4aS,5R,5aR,12aR)-6-[(4-cyanophenyl)methylidene]-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5R,5aR,12aR)-6-[(4-cyanophenyl)methylidene]-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91372977 |
| Molecular Formula | C29H25N3O8 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | (4R,4aS,5R,5aR,12aR)-6-[(4-cyanophenyl)methylidene]-4-(dimethylamino)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(O)cccc4C(=Cc4ccc(C#N)cc4)[C@@H]3[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C29H25N3O8/c1-32(2)22-21-24(35)18-15(10-12-6-8-13(11-30)9-7-12)14-4-3-5-16(33)17(14)23(34)19(18)26(37)29(21,40)27(38)20(25(22)36)28(31)39/h3-10,18-22,24,33,35,40H,1-2H3,(H2,31,39)/t18-,19?,20?,21-,22+,24+,29+/m0/s1 |
| InChIKey | WXLOBSMJWGNNNW-UEVSPCOJSA-N |
| XLogP | -0.29 |
| TPSA | 199.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|