C21H20O10 — CID 90990915
(4aR,5R,5aR,12aS)-2-acetyl-5,6,10,12a-tetrahydroxy-6-(hydroxymethyl)-4a,5,5a,11a-tetrahydro-4H-tetracene-1,3,11,12-tetrone (PubChem CID 90990915) has the molecular formula C21H20O10 and a molecular weight of 432.38 g/mol. Its IUPAC name is (4aR,5R,5aR,12aS)-2-acetyl-5,6,10,12a-tetrahydroxy-6-(hydroxymethyl)-4a,5,5a,11a-tetrahydro-4H-tetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5R,5aR,12aS)-2-acetyl-5,6,10,12a-tetrahydroxy-6-(hydroxymethyl)-4a,5,5a,11a-tetrahydro-4H-tetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 90990915 |
| Molecular Formula | C21H20O10 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (4aR,5R,5aR,12aS)-2-acetyl-5,6,10,12a-tetrahydroxy-6-(hydroxymethyl)-4a,5,5a,11a-tetrahydro-4H-tetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)C[C@@H]2[C@@H](O)[C@H]3C(C(=O)c4c(O)cccc4C3(O)CO)C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C21H20O10/c1-7(23)12-11(25)5-9-16(26)15-14(19(29)21(9,31)18(12)28)17(27)13-8(20(15,30)6-22)3-2-4-10(13)24/h2-4,9,12,14-16,22,24,26,30-31H,5-6H2,1H3/t9-,12?,14?,15-,16-,20?,21-/m1/s1 |
| InChIKey | BLFCETUIWMHDEX-VKEQLWRUSA-N |
| XLogP | -1.96 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|