C31H32N2O9 — CID 91059567
(4aR,5S,5aR,12aS)-5,10,12a-trihydroxy-7-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91059567) has the molecular formula C31H32N2O9 and a molecular weight of 576.60 g/mol. Its IUPAC name is (4aR,5S,5aR,12aS)-5,10,12a-trihydroxy-7-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,12aS)-5,10,12a-trihydroxy-7-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91059567 |
| Molecular Formula | C31H32N2O9 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | (4aR,5S,5aR,12aS)-5,10,12a-trihydroxy-7-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | COc1ccc(CN2CCCC2)cc1-c1ccc(O)c2c1C[C@@H]1C(C2=O)C(=O)[C@]2(O)C(=O)C(C(N)=O)C(=O)C[C@@H]2[C@H]1O |
| InChI | InChI=1S/C31H32N2O9/c1-42-22-7-4-14(13-33-8-2-3-9-33)10-16(22)15-5-6-20(34)23-17(15)11-18-24(27(23)37)28(38)31(41)19(26(18)36)12-21(35)25(29(31)39)30(32)40/h4-7,10,18-19,24-26,34,36,41H,2-3,8-9,11-13H2,1H3,(H2,32,40)/t18-,19-,24?,25?,26+,31+/m1/s1 |
| InChIKey | UCWNMVFVOLGAOX-FDPZTGKJSA-N |
| XLogP | 0.57 |
| TPSA | 184.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|