C34H41N3O8 — CID 123510135
9-(5-anilino-2-methylpentan-2-yl)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123510135) has the molecular formula C34H41N3O8 and a molecular weight of 619.72 g/mol. Its IUPAC name is 9-(5-anilino-2-methylpentan-2-yl)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 9-(5-anilino-2-methylpentan-2-yl)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123510135 |
| Molecular Formula | C34H41N3O8 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.29 |
| IUPAC Name | 9-(5-anilino-2-methylpentan-2-yl)-4-(dimethylamino)-5,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC1c2ccc(C(C)(C)CCCNc3ccccc3)c(O)c2C(=O)C2C(=O)C3(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C34H41N3O8/c1-16-18-12-13-19(33(2,3)14-9-15-36-17-10-7-6-8-11-17)26(38)21(18)27(39)22-20(16)28(40)24-25(37(4)5)29(41)23(32(35)44)31(43)34(24,45)30(22)42/h6-8,10-13,16,20,22-25,28,36,38,40,45H,9,14-15H2,1-5H3,(H2,35,44) |
| InChIKey | FVJKUVSRLKITSF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 187.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|