C27H29N3O9 — CID 123306928
[2-carbamoyl-4-(dimethylamino)-9-(ethenylideneamino)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] propanoate (PubChem CID 123306928) has the molecular formula C27H29N3O9 and a molecular weight of 539.54 g/mol. Its IUPAC name is [2-carbamoyl-4-(dimethylamino)-9-(ethenylideneamino)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] propanoate.
| Compound Name | [2-carbamoyl-4-(dimethylamino)-9-(ethenylideneamino)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] propanoate |
|---|---|
| PubChem CID | 123306928 |
| Molecular Formula | C27H29N3O9 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | [2-carbamoyl-4-(dimethylamino)-9-(ethenylideneamino)-10,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracen-5-yl] propanoate |
| SMILES | C=C=Nc1ccc2c(c1O)C(=O)C1C(=O)C3(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)C3C(OC(=O)CC)C1C2C |
| InChI | InChI=1S/C27H29N3O9/c1-6-13(31)39-23-14-10(3)11-8-9-12(29-7-2)20(32)15(11)21(33)16(14)24(35)27(38)18(23)19(30(4)5)22(34)17(25(27)36)26(28)37/h8-10,14,16-19,23,32,38H,2,6H2,1,3-5H3,(H2,28,37) |
| InChIKey | RCAHNRIRSYJDOD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|