C20H18ClN3O10 — CID 24885825
(4aR,5S,5aR,6R,12aS)-9-amino-8-chloro-5,10,12a-trihydroxy-6-methyl-7-nitro-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 24885825) has the molecular formula C20H18ClN3O10 and a molecular weight of 495.83 g/mol. Its IUPAC name is (4aR,5S,5aR,6R,12aS)-9-amino-8-chloro-5,10,12a-trihydroxy-6-methyl-7-nitro-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,6R,12aS)-9-amino-8-chloro-5,10,12a-trihydroxy-6-methyl-7-nitro-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 24885825 |
| Molecular Formula | C20H18ClN3O10 |
| Molecular Weight | 495.83 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | (4aR,5S,5aR,6R,12aS)-9-amino-8-chloro-5,10,12a-trihydroxy-6-methyl-7-nitro-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@H]1c2c(c(O)c(N)c(Cl)c2[N+](=O)[O-])C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C20H18ClN3O10/c1-3-6-9(16(28)12(22)11(21)13(6)24(33)34)15(27)10-7(3)14(26)4-2-5(25)8(19(23)31)17(29)20(4,32)18(10)30/h3-4,7-8,10,14,26,28,32H,2,22H2,1H3,(H2,23,31)/t3-,4+,7+,8?,10?,14+,20+/m0/s1 |
| InChIKey | BLTWNMVGUJSTRE-DPOVZLSTSA-N |
| XLogP | -1.00 |
| TPSA | 241.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.83 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|