C20H18ClN3O10 — CID 10128222
(4aS,5aS,6R,12aS)-9-amino-8-chloro-6,10,12a-trihydroxy-6-methyl-7-nitro-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 10128222) has the molecular formula C20H18ClN3O10 and a molecular weight of 495.83 g/mol. Its IUPAC name is (4aS,5aS,6R,12aS)-9-amino-8-chloro-6,10,12a-trihydroxy-6-methyl-7-nitro-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aS,6R,12aS)-9-amino-8-chloro-6,10,12a-trihydroxy-6-methyl-7-nitro-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 10128222 |
| Molecular Formula | C20H18ClN3O10 |
| Molecular Weight | 495.83 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | (4aS,5aS,6R,12aS)-9-amino-8-chloro-6,10,12a-trihydroxy-6-methyl-7-nitro-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C[C@]1(O)c2c(c(O)c(N)c(Cl)c2[N+](=O)[O-])C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C20H18ClN3O10/c1-19(31)5-2-4-3-6(25)8(18(23)30)17(29)20(4,32)16(28)7(5)14(26)9-10(19)13(24(33)34)11(21)12(22)15(9)27/h4-5,7-8,27,31-32H,2-3,22H2,1H3,(H2,23,30)/t4-,5-,7?,8?,19+,20-/m0/s1 |
| InChIKey | PMVNAHBNYCPNAV-ASHZXLPKSA-N |
| XLogP | -0.86 |
| TPSA | 241.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.83 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|