C22H21ClN2O9 — CID 10217681
(4aS,5aS,6S,12aS)-7-acetamido-8-chloro-6,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 10217681) has the molecular formula C22H21ClN2O9 and a molecular weight of 492.87 g/mol. Its IUPAC name is (4aS,5aS,6S,12aS)-7-acetamido-8-chloro-6,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aS,6S,12aS)-7-acetamido-8-chloro-6,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 10217681 |
| Molecular Formula | C22H21ClN2O9 |
| Molecular Weight | 492.87 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | (4aS,5aS,6S,12aS)-7-acetamido-8-chloro-6,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(=O)Nc1c(Cl)cc(O)c2c1[C@@](C)(O)[C@H]1C[C@H]3CC(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C22H21ClN2O9/c1-6(26)25-16-9(23)5-11(28)13-15(16)21(2,33)8-3-7-4-10(27)14(20(24)32)19(31)22(7,34)18(30)12(8)17(13)29/h5,7-8,12,14,28,33-34H,3-4H2,1-2H3,(H2,24,32)(H,25,26)/t7-,8-,12?,14?,21-,22-/m0/s1 |
| InChIKey | VNFQAOJVCUNEIV-CCMQTXKTSA-N |
| XLogP | -0.40 |
| TPSA | 201.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.87 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|