C20H20ClN3O8 — CID 10322268
(4R,4aS,5aR,6S,12aS)-7,9-diamino-8-chloro-4,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 10322268) has the molecular formula C20H20ClN3O8 and a molecular weight of 465.85 g/mol. Its IUPAC name is (4R,4aS,5aR,6S,12aS)-7,9-diamino-8-chloro-4,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,6S,12aS)-7,9-diamino-8-chloro-4,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 10322268 |
| Molecular Formula | C20H20ClN3O8 |
| Molecular Weight | 465.85 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | (4R,4aS,5aR,6S,12aS)-7,9-diamino-8-chloro-4,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@@H]1c2c(N)c(Cl)c(N)c(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@H](O)[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C20H20ClN3O8/c1-3-4-2-5-13(25)16(28)9(19(24)31)18(30)20(5,32)17(29)7(4)14(26)8-6(3)11(22)10(21)12(23)15(8)27/h3-5,7,9,13,25,27,32H,2,22-23H2,1H3,(H2,24,31)/t3-,4+,5-,7?,9?,13+,20-/m0/s1 |
| InChIKey | NLSHHKWJIJMTMY-DWSRDCLRSA-N |
| XLogP | -1.32 |
| TPSA | 224.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.85 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|