C28H35ClN4O7 — CID 123813593
(4S,4aS,5aR,12aS)-9-amino-8-(azepan-1-ylmethyl)-7-chloro-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123813593) has the molecular formula C28H35ClN4O7 and a molecular weight of 575.06 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-9-amino-8-(azepan-1-ylmethyl)-7-chloro-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-9-amino-8-(azepan-1-ylmethyl)-7-chloro-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123813593 |
| Molecular Formula | C28H35ClN4O7 |
| Molecular Weight | 575.06 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | (4S,4aS,5aR,12aS)-9-amino-8-(azepan-1-ylmethyl)-7-chloro-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)c(N)c(CN5CCCCCC5)c(Cl)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C28H35ClN4O7/c1-32(2)21-15-10-12-9-13-17(23(35)20(30)14(19(13)29)11-33-7-5-3-4-6-8-33)22(34)16(12)25(37)28(15,40)26(38)18(24(21)36)27(31)39/h12,15-16,18,21,35,40H,3-11,30H2,1-2H3,(H2,31,39)/t12-,15-,16?,18?,21-,28-/m0/s1 |
| InChIKey | SCBXURLNENSUBU-CQJGKWDWSA-N |
| XLogP | 0.48 |
| TPSA | 184.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.06 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|