C29H36ClN5O8 — CID 57245253
(4S,12aS)-8-chloro-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(2-pyrrolidin-1-ylacetyl)amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 57245253) has the molecular formula C29H36ClN5O8 and a molecular weight of 618.09 g/mol. Its IUPAC name is (4S,12aS)-8-chloro-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(2-pyrrolidin-1-ylacetyl)amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-8-chloro-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(2-pyrrolidin-1-ylacetyl)amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 57245253 |
| Molecular Formula | C29H36ClN5O8 |
| Molecular Weight | 618.09 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | (4S,12aS)-8-chloro-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(2-pyrrolidin-1-ylacetyl)amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1c(Cl)c(NC(=O)CN2CCCC2)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C29H36ClN5O8/c1-33(2)21-13-9-12-10-14-22(34(3)4)25(39)18(28(31)42)27(41)29(14,43)26(40)16(12)23(37)17(13)24(38)20(19(21)30)32-15(36)11-35-7-5-6-8-35/h12,14,16,18,22,38,43H,5-11H2,1-4H3,(H2,31,42)(H,32,36)/t12?,14?,16?,18?,22-,29-/m0/s1 |
| InChIKey | VKVHLOOCBMCOOT-IHANMGAKSA-N |
| XLogP | -0.38 |
| TPSA | 190.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.09 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|