C31H42N4O7 — CID 123908237
(4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-8-[(4,4-dimethylpiperidin-1-yl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123908237) has the molecular formula C31H42N4O7 and a molecular weight of 582.70 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-8-[(4,4-dimethylpiperidin-1-yl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-8-[(4,4-dimethylpiperidin-1-yl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123908237 |
| Molecular Formula | C31H42N4O7 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4,7-bis(dimethylamino)-8-[(4,4-dimethylpiperidin-1-yl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1c(CN2CCC(C)(C)CC2)cc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C31H42N4O7/c1-30(2)7-9-35(10-8-30)14-16-13-19(36)21-17(23(16)33(3)4)11-15-12-18-24(34(5)6)26(38)22(29(32)41)28(40)31(18,42)27(39)20(15)25(21)37/h13,15,18,20,22,24,36,42H,7-12,14H2,1-6H3,(H2,32,41)/t15-,18-,20?,22?,24-,31-/m0/s1 |
| InChIKey | XBRQNVLRMXWYLX-JRAFXBLPSA-N |
| XLogP | 0.56 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|