C32H44N4O7 — CID 123755979
(4S,4aS,5aR,12aS)-8-(azepan-1-ylmethyl)-4-(dimethylamino)-10,12a-dihydroxy-7-[methyl(propan-2-yl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123755979) has the molecular formula C32H44N4O7 and a molecular weight of 596.73 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-8-(azepan-1-ylmethyl)-4-(dimethylamino)-10,12a-dihydroxy-7-[methyl(propan-2-yl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-8-(azepan-1-ylmethyl)-4-(dimethylamino)-10,12a-dihydroxy-7-[methyl(propan-2-yl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123755979 |
| Molecular Formula | C32H44N4O7 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | (4S,4aS,5aR,12aS)-8-(azepan-1-ylmethyl)-4-(dimethylamino)-10,12a-dihydroxy-7-[methyl(propan-2-yl)amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)N(C)c1c(CN2CCCCCC2)cc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C32H44N4O7/c1-16(2)35(5)25-18(15-36-10-8-6-7-9-11-36)14-21(37)23-19(25)12-17-13-20-26(34(3)4)28(39)24(31(33)42)30(41)32(20,43)29(40)22(17)27(23)38/h14,16-17,20,22,24,26,37,43H,6-13,15H2,1-5H3,(H2,33,42)/t17-,20-,22?,24?,26-,32-/m0/s1 |
| InChIKey | FFCLZAZSABBMIO-RAWJXRTQSA-N |
| XLogP | 1.09 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|