C32H43N3O8 — CID 123537261
(4S,4aS,5aR,12aS)-8-[(4-tert-butylpiperidin-1-yl)methyl]-4-(dimethylamino)-10,12a-dihydroxy-7-methoxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123537261) has the molecular formula C32H43N3O8 and a molecular weight of 597.71 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-8-[(4-tert-butylpiperidin-1-yl)methyl]-4-(dimethylamino)-10,12a-dihydroxy-7-methoxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-8-[(4-tert-butylpiperidin-1-yl)methyl]-4-(dimethylamino)-10,12a-dihydroxy-7-methoxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123537261 |
| Molecular Formula | C32H43N3O8 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | (4S,4aS,5aR,12aS)-8-[(4-tert-butylpiperidin-1-yl)methyl]-4-(dimethylamino)-10,12a-dihydroxy-7-methoxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | COc1c(CN2CCC(C(C)(C)C)CC2)cc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C32H43N3O8/c1-31(2,3)17-7-9-35(10-8-17)14-16-13-20(36)22-18(27(16)43-6)11-15-12-19-24(34(4)5)26(38)23(30(33)41)29(40)32(19,42)28(39)21(15)25(22)37/h13,15,17,19,21,23-24,36,42H,7-12,14H2,1-6H3,(H2,33,41)/t15-,19-,21?,23?,24-,32-/m0/s1 |
| InChIKey | BSNRPIBJJHUWEK-RLHPGEGVSA-N |
| XLogP | 1.13 |
| TPSA | 167.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|