C34H44N4O7 — CID 123580181
(4S,4aS,5aR,12aS)-8-[(2-adamantylamino)methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123580181) has the molecular formula C34H44N4O7 and a molecular weight of 620.75 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-8-[(2-adamantylamino)methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-8-[(2-adamantylamino)methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123580181 |
| Molecular Formula | C34H44N4O7 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.32 |
| IUPAC Name | (4S,4aS,5aR,12aS)-8-[(2-adamantylamino)methyl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1c(CNC2C3CC4CC(C3)CC2C4)cc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C34H44N4O7/c1-37(2)27-19(13-36-26-17-6-14-5-15(8-17)9-18(26)7-14)12-22(39)24-20(27)10-16-11-21-28(38(3)4)30(41)25(33(35)44)32(43)34(21,45)31(42)23(16)29(24)40/h12,14-18,21,23,25-26,28,36,39,45H,5-11,13H2,1-4H3,(H2,35,44)/t14?,15?,16-,17?,18?,21-,23?,25?,26?,28-,34-/m0/s1 |
| InChIKey | ORBRJKPSQRYZED-PQNNKZIUSA-N |
| XLogP | 0.85 |
| TPSA | 170.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|