C25H29FN4O8 — CID 123860412
(4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-8-[[methyl(methylcarbamoyl)amino]methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123860412) has the molecular formula C25H29FN4O8 and a molecular weight of 532.53 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-8-[[methyl(methylcarbamoyl)amino]methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-8-[[methyl(methylcarbamoyl)amino]methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123860412 |
| Molecular Formula | C25H29FN4O8 |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-8-[[methyl(methylcarbamoyl)amino]methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CNC(=O)N(C)Cc1cc(O)c2c(c1F)C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C25H29FN4O8/c1-28-24(37)30(4)8-10-7-13(31)15-11(17(10)26)5-9-6-12-18(29(2)3)20(33)16(23(27)36)22(35)25(12,38)21(34)14(9)19(15)32/h7,9,12,14,16,18,31,38H,5-6,8H2,1-4H3,(H2,27,36)(H,28,37)/t9-,12-,14?,16?,18-,25-/m0/s1 |
| InChIKey | SFHXFCGBHDLCRD-KEDAGMJUSA-N |
| XLogP | -1.22 |
| TPSA | 187.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|