C30H38FN3O7 — CID 91230056
8-[[cyclopropyl(2,2-dimethylpropyl)amino]methyl]-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91230056) has the molecular formula C30H38FN3O7 and a molecular weight of 571.65 g/mol. Its IUPAC name is 8-[[cyclopropyl(2,2-dimethylpropyl)amino]methyl]-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 8-[[cyclopropyl(2,2-dimethylpropyl)amino]methyl]-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91230056 |
| Molecular Formula | C30H38FN3O7 |
| Molecular Weight | 571.65 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | 8-[[cyclopropyl(2,2-dimethylpropyl)amino]methyl]-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)C(=O)C2(O)C(=O)C3C(=O)c4c(O)cc(CN(CC(C)(C)C)C5CC5)c(F)c4CC3CC12 |
| InChI | InChI=1S/C30H38FN3O7/c1-29(2,3)12-34(15-6-7-15)11-14-10-18(35)20-16(22(14)31)8-13-9-17-23(33(4)5)25(37)21(28(32)40)27(39)30(17,41)26(38)19(13)24(20)36/h10,13,15,17,19,21,23,35,41H,6-9,11-12H2,1-5H3,(H2,32,40) |
| InChIKey | GZZCLZPZMDMNLS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.65 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|