C28H36ClN3O7 — CID 91121746
7-chloro-4-(dimethylamino)-8-[(3,3-dimethylbutan-2-ylamino)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91121746) has the molecular formula C28H36ClN3O7 and a molecular weight of 562.06 g/mol. Its IUPAC name is 7-chloro-4-(dimethylamino)-8-[(3,3-dimethylbutan-2-ylamino)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 7-chloro-4-(dimethylamino)-8-[(3,3-dimethylbutan-2-ylamino)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91121746 |
| Molecular Formula | C28H36ClN3O7 |
| Molecular Weight | 562.06 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | 7-chloro-4-(dimethylamino)-8-[(3,3-dimethylbutan-2-ylamino)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(NCc1cc(O)c2c(c1Cl)CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O)C(C)(C)C |
| InChI | InChI=1S/C28H36ClN3O7/c1-11(27(2,3)4)31-10-13-9-16(33)18-14(20(13)29)7-12-8-15-21(32(5)6)23(35)19(26(30)38)25(37)28(15,39)24(36)17(12)22(18)34/h9,11-12,15,17,19,21,31,33,39H,7-8,10H2,1-6H3,(H2,30,38) |
| InChIKey | VKLWIMYNYPSIDG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.06 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|