C29H38ClN3O7 — CID 123870194
(4S,4aS,5aR,12aS)-7-chloro-4-(dimethylamino)-10,12a-dihydroxy-8-[2-[methyl(2-methylpropyl)amino]propan-2-yl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123870194) has the molecular formula C29H38ClN3O7 and a molecular weight of 576.09 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-7-chloro-4-(dimethylamino)-10,12a-dihydroxy-8-[2-[methyl(2-methylpropyl)amino]propan-2-yl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-7-chloro-4-(dimethylamino)-10,12a-dihydroxy-8-[2-[methyl(2-methylpropyl)amino]propan-2-yl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123870194 |
| Molecular Formula | C29H38ClN3O7 |
| Molecular Weight | 576.09 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | (4S,4aS,5aR,12aS)-7-chloro-4-(dimethylamino)-10,12a-dihydroxy-8-[2-[methyl(2-methylpropyl)amino]propan-2-yl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)CN(C)C(C)(C)c1cc(O)c2c(c1Cl)C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C29H38ClN3O7/c1-12(2)11-33(7)28(3,4)15-10-17(34)19-14(21(15)30)8-13-9-16-22(32(5)6)24(36)20(27(31)39)26(38)29(16,40)25(37)18(13)23(19)35/h10,12-13,16,18,20,22,34,40H,8-9,11H2,1-7H3,(H2,31,39)/t13-,16-,18?,20?,22-,29-/m0/s1 |
| InChIKey | NNBZEPYDEOXXGE-BPOHCMLOSA-N |
| XLogP | 1.34 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.09 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|