C25H28Cl2N4O8 — CID 57306885
8-chloro-9-[(2-chloroacetyl)amino]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 57306885) has the molecular formula C25H28Cl2N4O8 and a molecular weight of 583.43 g/mol. Its IUPAC name is 8-chloro-9-[(2-chloroacetyl)amino]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 8-chloro-9-[(2-chloroacetyl)amino]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 57306885 |
| Molecular Formula | C25H28Cl2N4O8 |
| Molecular Weight | 583.43 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | 8-chloro-9-[(2-chloroacetyl)amino]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1c(Cl)c(NC(=O)CCl)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C25H28Cl2N4O8/c1-30(2)17-9-5-8-6-10-18(31(3)4)21(35)14(24(28)38)23(37)25(10,39)22(36)12(8)19(33)13(9)20(34)16(15(17)27)29-11(32)7-26/h8,10,12,14,18,34,39H,5-7H2,1-4H3,(H2,28,38)(H,29,32) |
| InChIKey | FAOONKLPWRPLRW-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 187.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.43 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|