C22H25ClN4O7 — CID 123767352
(6aS,10S,10aS,11aR)-1-chloro-10-(dimethylamino)-3-(ethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydronaphtho[3,2-g]isoquinoline-8-carboxamide (PubChem CID 123767352) has the molecular formula C22H25ClN4O7 and a molecular weight of 492.92 g/mol. Its IUPAC name is (6aS,10S,10aS,11aR)-1-chloro-10-(dimethylamino)-3-(ethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydronaphtho[3,2-g]isoquinoline-8-carboxamide.
| Compound Name | (6aS,10S,10aS,11aR)-1-chloro-10-(dimethylamino)-3-(ethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydronaphtho[3,2-g]isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 123767352 |
| Molecular Formula | C22H25ClN4O7 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | (6aS,10S,10aS,11aR)-1-chloro-10-(dimethylamino)-3-(ethylamino)-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydronaphtho[3,2-g]isoquinoline-8-carboxamide |
| SMILES | CCNc1nc(Cl)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C22H25ClN4O7/c1-4-25-21-16(30)11-8(19(23)26-21)5-7-6-9-13(27(2)3)15(29)12(20(24)33)18(32)22(9,34)17(31)10(7)14(11)28/h7,9-10,12-13,30,34H,4-6H2,1-3H3,(H2,24,33)(H,25,26)/t7-,9-,10?,12?,13-,22-/m0/s1 |
| InChIKey | BETMJRUZITUVKM-BGBUJKPZSA-N |
| XLogP | -0.65 |
| TPSA | 179.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|