C30H40N4O7 — CID 123598013
(1R,15S,19S,20S)-4,19-bis(dimethylamino)-10,15-dihydroxy-7-(2-methylbutan-2-yl)-12,14,16,18-tetraoxo-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-3(11),4,9-triene-17-carboxamide (PubChem CID 123598013) has the molecular formula C30H40N4O7 and a molecular weight of 568.67 g/mol. Its IUPAC name is (1R,15S,19S,20S)-4,19-bis(dimethylamino)-10,15-dihydroxy-7-(2-methylbutan-2-yl)-12,14,16,18-tetraoxo-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-3(11),4,9-triene-17-carboxamide.
| Compound Name | (1R,15S,19S,20S)-4,19-bis(dimethylamino)-10,15-dihydroxy-7-(2-methylbutan-2-yl)-12,14,16,18-tetraoxo-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-3(11),4,9-triene-17-carboxamide |
|---|---|
| PubChem CID | 123598013 |
| Molecular Formula | C30H40N4O7 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | (1R,15S,19S,20S)-4,19-bis(dimethylamino)-10,15-dihydroxy-7-(2-methylbutan-2-yl)-12,14,16,18-tetraoxo-7-azapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-3(11),4,9-triene-17-carboxamide |
| SMILES | CCC(C)(C)N1Cc2c(O)c3c(c(N(C)C)c2C1)C[C@H]1C[C@H]2[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C1C3=O |
| InChI | InChI=1S/C30H40N4O7/c1-8-29(2,3)34-11-15-16(12-34)23(35)19-14(21(15)32(4)5)9-13-10-17-22(33(6)7)25(37)20(28(31)40)27(39)30(17,41)26(38)18(13)24(19)36/h13,17-18,20,22,35,41H,8-12H2,1-7H3,(H2,31,40)/t13-,17-,18?,20?,22-,30-/m0/s1 |
| InChIKey | WYPJJRMPIFHETL-QYOXXEQJSA-N |
| XLogP | 0.44 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|