C26H30BrClN4O8 — CID 56994294
(4S,12aS)-9-(2-bromopropanoylamino)-8-chloro-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 56994294) has the molecular formula C26H30BrClN4O8 and a molecular weight of 641.90 g/mol. Its IUPAC name is (4S,12aS)-9-(2-bromopropanoylamino)-8-chloro-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-9-(2-bromopropanoylamino)-8-chloro-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 56994294 |
| Molecular Formula | C26H30BrClN4O8 |
| Molecular Weight | 641.90 g/mol |
| Exact Mass | 640.09 |
| IUPAC Name | (4S,12aS)-9-(2-bromopropanoylamino)-8-chloro-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(Br)C(=O)Nc1c(O)c2c(c(N(C)C)c1Cl)CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C26H30BrClN4O8/c1-8(27)25(39)30-16-15(28)17(31(2)3)10-6-9-7-11-18(32(4)5)21(35)14(24(29)38)23(37)26(11,40)22(36)12(9)19(33)13(10)20(16)34/h8-9,11-12,14,18,34,40H,6-7H2,1-5H3,(H2,29,38)(H,30,39)/t8?,9?,11?,12?,14?,18-,26-/m0/s1 |
| InChIKey | DZNVMIFNOYITQI-OCFDHIHCSA-N |
| XLogP | 0.31 |
| TPSA | 187.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.90 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|