C34H37N3O7 — CID 71159470
methyl 4-[[[9-carbamoyl-10-cyclopropylidene-4-(dimethylamino)-1,8,12-trihydroxy-11-oxo-5,5a,6,6a,7,10a-hexahydrotetracen-2-yl]methylamino]methyl]benzoate (PubChem CID 71159470) has the molecular formula C34H37N3O7 and a molecular weight of 599.68 g/mol. Its IUPAC name is methyl 4-[[[9-carbamoyl-10-cyclopropylidene-4-(dimethylamino)-1,8,12-trihydroxy-11-oxo-5,5a,6,6a,7,10a-hexahydrotetracen-2-yl]methylamino]methyl]benzoate.
| Compound Name | methyl 4-[[[9-carbamoyl-10-cyclopropylidene-4-(dimethylamino)-1,8,12-trihydroxy-11-oxo-5,5a,6,6a,7,10a-hexahydrotetracen-2-yl]methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 71159470 |
| Molecular Formula | C34H37N3O7 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | methyl 4-[[[9-carbamoyl-10-cyclopropylidene-4-(dimethylamino)-1,8,12-trihydroxy-11-oxo-5,5a,6,6a,7,10a-hexahydrotetracen-2-yl]methylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNCc2cc(N(C)C)c3c(c2O)C(O)=C2C(=O)C4C(=C5CC5)C(C(N)=O)=C(O)CC4CC2C3)cc1 |
| InChI | InChI=1S/C34H37N3O7/c1-37(2)23-12-21(15-36-14-16-4-6-18(7-5-16)34(43)44-3)30(39)28-22(23)11-19-10-20-13-24(38)29(33(35)42)25(17-8-9-17)26(20)31(40)27(19)32(28)41/h4-7,12,19-20,26,36,38-39,41H,8-11,13-15H2,1-3H3,(H2,35,42) |
| InChIKey | UWDJOVZGIHNMSW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 162.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|