C24H26N2O6 — CID 177229466
7-cyclopropyl-4-(dimethylamino)-1,10,11,12-tetrahydroxy-3-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 177229466) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is 7-cyclopropyl-4-(dimethylamino)-1,10,11,12-tetrahydroxy-3-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-cyclopropyl-4-(dimethylamino)-1,10,11,12-tetrahydroxy-3-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229466 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 7-cyclopropyl-4-(dimethylamino)-1,10,11,12-tetrahydroxy-3-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2=C(O)C3=C(O)c4c(O)ccc(C5CC5)c4CC3CC21 |
| InChI | InChI=1S/C24H26N2O6/c1-26(2)19-13-8-10-7-12-11(9-3-4-9)5-6-14(27)16(12)20(28)15(10)21(29)17(13)22(30)18(23(19)31)24(25)32/h5-6,9-10,13,19,27-30H,3-4,7-8H2,1-2H3,(H2,25,32) |
| InChIKey | CEVCNRJOGMOKIL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|