C30H30ClN3O7 — CID 167335853
(4S,4aS,5aR,12aR)-7-chloro-8-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-1,10,11,12a-tetrahydroxy-4-(methylamino)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 167335853) has the molecular formula C30H30ClN3O7 and a molecular weight of 580.04 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-7-chloro-8-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-1,10,11,12a-tetrahydroxy-4-(methylamino)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-7-chloro-8-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-1,10,11,12a-tetrahydroxy-4-(methylamino)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 167335853 |
| Molecular Formula | C30H30ClN3O7 |
| Molecular Weight | 580.04 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | (4S,4aS,5aR,12aR)-7-chloro-8-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-1,10,11,12a-tetrahydroxy-4-(methylamino)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(CN5CCc6ccccc6C5)c(Cl)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C30H30ClN3O7/c1-33-24-18-9-15-8-17-21(25(36)20(15)27(38)30(18,41)28(39)22(26(24)37)29(32)40)19(35)10-16(23(17)31)12-34-7-6-13-4-2-3-5-14(13)11-34/h2-5,10,15,18,24,33,35-36,39,41H,6-9,11-12H2,1H3,(H2,32,40)/t15-,18-,24-,30-/m0/s1 |
| InChIKey | GKNJIRPFXORHQT-JOSRSFNQSA-N |
| XLogP | 1.83 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.04 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|