C19H18ClN3O7 — CID 54682790
(4aS,5aR,12aR)-7,9-diamino-8-chloro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54682790) has the molecular formula C19H18ClN3O7 and a molecular weight of 435.82 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7,9-diamino-8-chloro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7,9-diamino-8-chloro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54682790 |
| Molecular Formula | C19H18ClN3O7 |
| Molecular Weight | 435.82 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | (4aS,5aR,12aR)-7,9-diamino-8-chloro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(N)c(Cl)c(N)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C19H18ClN3O7/c20-11-12(21)6-2-4-1-5-3-7(24)10(18(23)29)17(28)19(5,30)16(27)8(4)14(25)9(6)15(26)13(11)22/h4-5,25-26,28,30H,1-3,21-22H2,(H2,23,29)/t4-,5+,19+/m1/s1 |
| InChIKey | MZIREFULWCTWQI-QMNXZWIWSA-N |
| XLogP | 0.24 |
| TPSA | 210.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.82 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|