C22H18N2O7 — CID 134232746
(8aR,13aR)-7,8a,9-trihydroxy-6,8,11-trioxo-5,12,12a,13,13a,14-hexahydronaphtho[3,2-j]phenanthridine-10-carboxamide (PubChem CID 134232746) has the molecular formula C22H18N2O7 and a molecular weight of 422.39 g/mol. Its IUPAC name is (8aR,13aR)-7,8a,9-trihydroxy-6,8,11-trioxo-5,12,12a,13,13a,14-hexahydronaphtho[3,2-j]phenanthridine-10-carboxamide.
| Compound Name | (8aR,13aR)-7,8a,9-trihydroxy-6,8,11-trioxo-5,12,12a,13,13a,14-hexahydronaphtho[3,2-j]phenanthridine-10-carboxamide |
|---|---|
| PubChem CID | 134232746 |
| Molecular Formula | C22H18N2O7 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (8aR,13aR)-7,8a,9-trihydroxy-6,8,11-trioxo-5,12,12a,13,13a,14-hexahydronaphtho[3,2-j]phenanthridine-10-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(c5ccccc5[nH]c4=O)C[C@H]3CC2CC1=O |
| InChI | InChI=1S/C22H18N2O7/c23-20(29)16-13(25)7-9-5-8-6-11-10-3-1-2-4-12(10)24-21(30)15(11)17(26)14(8)18(27)22(9,31)19(16)28/h1-4,8-9,26,28,31H,5-7H2,(H2,23,29)(H,24,30)/t8-,9?,22+/m1/s1 |
| InChIKey | QEILOVZUYLWBSU-HOCXVPKNSA-N |
| XLogP | 0.56 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|