C24H25N3O9 — CID 58647399
N-[(5aR,6aS,10aR)-9-carbamoyl-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]morpholine-4-carboxamide (PubChem CID 58647399) has the molecular formula C24H25N3O9 and a molecular weight of 499.48 g/mol. Its IUPAC name is N-[(5aR,6aS,10aR)-9-carbamoyl-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(5aR,6aS,10aR)-9-carbamoyl-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 58647399 |
| Molecular Formula | C24H25N3O9 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-[(5aR,6aS,10aR)-9-carbamoyl-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]morpholine-4-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(ccc(NC(=O)N5CCOCC5)c4O)C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C24H25N3O9/c25-22(33)17-14(28)9-12-8-11-7-10-1-2-13(26-23(34)27-3-5-36-6-4-27)18(29)15(10)19(30)16(11)20(31)24(12,35)21(17)32/h1-2,11-12,29-30,32,35H,3-9H2,(H2,25,33)(H,26,34)/t11-,12-,24-/m0/s1 |
| InChIKey | LMPDRFDIWUYLDT-CTRJTCCGSA-N |
| XLogP | 0.29 |
| TPSA | 199.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|