C31H29FN4O8 — CID 58627668
(4aS,5aR,12aR)-7-(dimethylamino)-9-[[[4-(4-fluorophenyl)-1,3-oxazol-2-yl]amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58627668) has the molecular formula C31H29FN4O8 and a molecular weight of 604.59 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(dimethylamino)-9-[[[4-(4-fluorophenyl)-1,3-oxazol-2-yl]amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(dimethylamino)-9-[[[4-(4-fluorophenyl)-1,3-oxazol-2-yl]amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58627668 |
| Molecular Formula | C31H29FN4O8 |
| Molecular Weight | 604.59 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | (4aS,5aR,12aR)-7-(dimethylamino)-9-[[[4-(4-fluorophenyl)-1,3-oxazol-2-yl]amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CNc2nc(-c3ccc(F)cc3)co2)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C31H29FN4O8/c1-36(2)20-9-15(11-34-30-35-19(12-44-30)13-3-5-17(32)6-4-13)25(38)23-18(20)8-14-7-16-10-21(37)24(29(33)42)28(41)31(16,43)27(40)22(14)26(23)39/h3-6,9,12,14,16,38-39,41,43H,7-8,10-11H2,1-2H3,(H2,33,42)(H,34,35)/t14-,16+,31+/m1/s1 |
| InChIKey | IVCQSZGGZSUJCI-ALJUEJSZSA-N |
| XLogP | 2.90 |
| TPSA | 199.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|