C29H29N5O7 — CID 58801879
(13R,15S,16S,20R)-10,16-bis(dimethylamino)-2,19,20-trihydroxy-17,21-dioxo-6-pyridin-4-yl-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1,3,6,8,10,18-hexaene-18-carboxamide (PubChem CID 58801879) has the molecular formula C29H29N5O7 and a molecular weight of 559.58 g/mol. Its IUPAC name is (13R,15S,16S,20R)-10,16-bis(dimethylamino)-2,19,20-trihydroxy-17,21-dioxo-6-pyridin-4-yl-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1,3,6,8,10,18-hexaene-18-carboxamide.
| Compound Name | (13R,15S,16S,20R)-10,16-bis(dimethylamino)-2,19,20-trihydroxy-17,21-dioxo-6-pyridin-4-yl-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1,3,6,8,10,18-hexaene-18-carboxamide |
|---|---|
| PubChem CID | 58801879 |
| Molecular Formula | C29H29N5O7 |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | (13R,15S,16S,20R)-10,16-bis(dimethylamino)-2,19,20-trihydroxy-17,21-dioxo-6-pyridin-4-yl-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1,3,6,8,10,18-hexaene-18-carboxamide |
| SMILES | CN(C)c1cc2nc(-c3ccncc3)oc2c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H29N5O7/c1-33(2)17-11-16-24(41-28(32-16)12-5-7-31-8-6-12)19-14(17)9-13-10-15-21(34(3)4)23(36)20(27(30)39)26(38)29(15,40)25(37)18(13)22(19)35/h5-8,11,13,15,21,35,38,40H,9-10H2,1-4H3,(H2,30,39)/t13-,15-,21-,29-/m0/s1 |
| InChIKey | NVPJISFTCNZRSI-OXZGANHMSA-N |
| XLogP | 1.53 |
| TPSA | 183.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|