C31H31N5O8 — CID 138512159
9-[[(4-acetylphenyl)carbamoylamino]methyl]-7-(dimethylamino)-3,10,11-trihydroxy-4-imino-1,12-dioxo-5,5a,6,12a-tetrahydro-4aH-tetracene-2-carboxamide (PubChem CID 138512159) has the molecular formula C31H31N5O8 and a molecular weight of 601.62 g/mol. Its IUPAC name is 9-[[(4-acetylphenyl)carbamoylamino]methyl]-7-(dimethylamino)-3,10,11-trihydroxy-4-imino-1,12-dioxo-5,5a,6,12a-tetrahydro-4aH-tetracene-2-carboxamide.
| Compound Name | 9-[[(4-acetylphenyl)carbamoylamino]methyl]-7-(dimethylamino)-3,10,11-trihydroxy-4-imino-1,12-dioxo-5,5a,6,12a-tetrahydro-4aH-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 138512159 |
| Molecular Formula | C31H31N5O8 |
| Molecular Weight | 601.62 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | 9-[[(4-acetylphenyl)carbamoylamino]methyl]-7-(dimethylamino)-3,10,11-trihydroxy-4-imino-1,12-dioxo-5,5a,6,12a-tetrahydro-4aH-tetracene-2-carboxamide |
| SMILES | [H]/N=C1/C(O)=C(C(N)=O)C(=O)C2C(=O)C3=C(O)c4c(O)c(CNC(=O)Nc5ccc(C(C)=O)cc5)cc(N(C)C)c4CC3CC12 |
| InChI | InChI=1S/C31H31N5O8/c1-12(37)13-4-6-16(7-5-13)35-31(44)34-11-15-10-19(36(2)3)17-8-14-9-18-22(27(40)20(14)26(39)21(17)25(15)38)28(41)23(30(33)43)29(42)24(18)32/h4-7,10,14,18,22,32,38-39,42H,8-9,11H2,1-3H3,(H2,33,43)(H2,34,35,44)/b32-24+ |
| InChIKey | XTGHZOVTPZQOFK-FEZSWGLMSA-N |
| XLogP | 2.53 |
| TPSA | 223.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.62 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|