C28H37N5O7 — CID 162246668
(4S,4aS,5aR,12aR)-9-[(2-cyanoethylamino)methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;methane (PubChem CID 162246668) has the molecular formula C28H37N5O7 and a molecular weight of 555.63 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-[(2-cyanoethylamino)methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;methane.
| Compound Name | (4S,4aS,5aR,12aR)-9-[(2-cyanoethylamino)methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;methane |
|---|---|
| PubChem CID | 162246668 |
| Molecular Formula | C28H37N5O7 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-[(2-cyanoethylamino)methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;methane |
| SMILES | C.CN(C)c1cc(CNCCC#N)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C27H33N5O7.CH4/c1-31(2)16-10-13(11-30-7-5-6-28)21(33)18-14(16)8-12-9-15-20(32(3)4)23(35)19(26(29)38)25(37)27(15,39)24(36)17(12)22(18)34;/h10,12,15,20,30,33-34,37,39H,5,7-9,11H2,1-4H3,(H2,29,38);1H4/t12-,15-,20-,27-;/m0./s1 |
| InChIKey | RSSDHGOLQMZBPM-YNVYHYDASA-N |
| XLogP | 0.67 |
| TPSA | 200.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|