C28H26BrN3O8 — CID 138512165
(4-bromophenyl) N-[9-carbamoyl-4-(dimethylamino)-1,10,12-trihydroxy-8,11-dioxo-5,5a,6,6a,7,10a-hexahydrotetracen-2-yl]carbamate (PubChem CID 138512165) has the molecular formula C28H26BrN3O8 and a molecular weight of 612.43 g/mol. Its IUPAC name is (4-bromophenyl) N-[9-carbamoyl-4-(dimethylamino)-1,10,12-trihydroxy-8,11-dioxo-5,5a,6,6a,7,10a-hexahydrotetracen-2-yl]carbamate.
| Compound Name | (4-bromophenyl) N-[9-carbamoyl-4-(dimethylamino)-1,10,12-trihydroxy-8,11-dioxo-5,5a,6,6a,7,10a-hexahydrotetracen-2-yl]carbamate |
|---|---|
| PubChem CID | 138512165 |
| Molecular Formula | C28H26BrN3O8 |
| Molecular Weight | 612.43 g/mol |
| Exact Mass | 611.09 |
| IUPAC Name | (4-bromophenyl) N-[9-carbamoyl-4-(dimethylamino)-1,10,12-trihydroxy-8,11-dioxo-5,5a,6,6a,7,10a-hexahydrotetracen-2-yl]carbamate |
| SMILES | CN(C)c1cc(NC(=O)Oc2ccc(Br)cc2)c(O)c2c1CC1CC3CC(=O)C(C(N)=O)=C(O)C3C(=O)C1=C2O |
| InChI | InChI=1S/C28H26BrN3O8/c1-32(2)17-10-16(31-28(39)40-14-5-3-13(29)4-6-14)23(34)21-15(17)8-11-7-12-9-18(33)22(27(30)38)26(37)20(12)24(35)19(11)25(21)36/h3-6,10-12,20,34,36-37H,7-9H2,1-2H3,(H2,30,38)(H,31,39) |
| InChIKey | OQNMXUKPYYMQLL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 179.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|