C24H24F5N3O6 — CID 118083535
1,10,11-trihydroxy-7-(methylamino)-3,12-dioxo-9-[(2,2,3,3,3-pentafluoropropylamino)methyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 118083535) has the molecular formula C24H24F5N3O6 and a molecular weight of 545.46 g/mol. Its IUPAC name is 1,10,11-trihydroxy-7-(methylamino)-3,12-dioxo-9-[(2,2,3,3,3-pentafluoropropylamino)methyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 1,10,11-trihydroxy-7-(methylamino)-3,12-dioxo-9-[(2,2,3,3,3-pentafluoropropylamino)methyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 118083535 |
| Molecular Formula | C24H24F5N3O6 |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 1,10,11-trihydroxy-7-(methylamino)-3,12-dioxo-9-[(2,2,3,3,3-pentafluoropropylamino)methyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CNc1cc(CNCC(F)(F)C(F)(F)F)c(O)c2c1CC1CC3CC(=O)C(C(N)=O)=C(O)C3C(=O)C1=C2O |
| InChI | InChI=1S/C24H24F5N3O6/c1-31-12-4-10(6-32-7-23(25,26)24(27,28)29)18(34)16-11(12)3-8-2-9-5-13(33)17(22(30)38)21(37)15(9)19(35)14(8)20(16)36/h4,8-9,15,31-32,34,36-37H,2-3,5-7H2,1H3,(H2,30,38) |
| InChIKey | PRHNZMNHSWUBBW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|