C23H23F3N2O6 — CID 70801795
1,10,11-trihydroxy-3,12-dioxo-9-[(3,3,3-trifluoropropylamino)methyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 70801795) has the molecular formula C23H23F3N2O6 and a molecular weight of 480.44 g/mol. Its IUPAC name is 1,10,11-trihydroxy-3,12-dioxo-9-[(3,3,3-trifluoropropylamino)methyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 1,10,11-trihydroxy-3,12-dioxo-9-[(3,3,3-trifluoropropylamino)methyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 70801795 |
| Molecular Formula | C23H23F3N2O6 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 1,10,11-trihydroxy-3,12-dioxo-9-[(3,3,3-trifluoropropylamino)methyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2C(=O)C3=C(O)c4c(ccc(CNCCC(F)(F)F)c4O)CC3CC2CC1=O |
| InChI | InChI=1S/C23H23F3N2O6/c24-23(25,26)3-4-28-8-10-2-1-9-5-11-6-12-7-13(29)17(22(27)34)21(33)16(12)20(32)15(11)19(31)14(9)18(10)30/h1-2,11-12,16,28,30-31,33H,3-8H2,(H2,27,34) |
| InChIKey | OKUHVORRHYGVMS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|