C19H17NO5 — CID 71214265
1,11-dihydroxy-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 71214265) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 1,11-dihydroxy-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 1,11-dihydroxy-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 71214265 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1,11-dihydroxy-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2C(=O)C3=C(O)c4ccccc4CC3CC2CC1=O |
| InChI | InChI=1S/C19H17NO5/c20-19(25)15-12(21)7-10-6-9-5-8-3-1-2-4-11(8)16(22)13(9)17(23)14(10)18(15)24/h1-4,9-10,14,22,24H,5-7H2,(H2,20,25) |
| InChIKey | AJOTYJDMGACMTI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|