C20H19NO6 — CID 146657226
(6R)-1,10,11-trihydroxy-6-methyl-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 146657226) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is (6R)-1,10,11-trihydroxy-6-methyl-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | (6R)-1,10,11-trihydroxy-6-methyl-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 146657226 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (6R)-1,10,11-trihydroxy-6-methyl-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@H]1c2cccc(O)c2C(O)=C2C(=O)C3C(O)=C(C(N)=O)C(=O)CC3CC21 |
| InChI | InChI=1S/C20H19NO6/c1-7-9-3-2-4-11(22)14(9)19(26)15-10(7)5-8-6-12(23)16(20(21)27)18(25)13(8)17(15)24/h2-4,7-8,10,13,22,25-26H,5-6H2,1H3,(H2,21,27)/t7-,8?,10?,13?/m0/s1 |
| InChIKey | HGHUMBRFMANLFJ-FPFLKUOQSA-N |
| XLogP | 1.87 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|