C26H20F3NO6 — CID 162544181
1,10,11-trihydroxy-3,12-dioxo-7-[4-(trifluoromethyl)phenyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 162544181) has the molecular formula C26H20F3NO6 and a molecular weight of 499.44 g/mol. Its IUPAC name is 1,10,11-trihydroxy-3,12-dioxo-7-[4-(trifluoromethyl)phenyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 1,10,11-trihydroxy-3,12-dioxo-7-[4-(trifluoromethyl)phenyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 162544181 |
| Molecular Formula | C26H20F3NO6 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 1,10,11-trihydroxy-3,12-dioxo-7-[4-(trifluoromethyl)phenyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2C(=O)C3=C(O)c4c(O)ccc(-c5ccc(C(F)(F)F)cc5)c4CC3CC2CC1=O |
| InChI | InChI=1S/C26H20F3NO6/c27-26(28,29)13-3-1-10(2-4-13)14-5-6-16(31)20-15(14)8-11-7-12-9-17(32)21(25(30)36)24(35)19(12)22(33)18(11)23(20)34/h1-6,11-12,19,31,34-35H,7-9H2,(H2,30,36) |
| InChIKey | QNZCQMLMIMICGN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|