C26H19F3N2O7 — CID 118952050
(4aS,12aS)-1,10,12a-trihydroxy-12-nitroso-3,11-dioxo-7-[4-(trifluoromethyl)phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 118952050) has the molecular formula C26H19F3N2O7 and a molecular weight of 528.44 g/mol. Its IUPAC name is (4aS,12aS)-1,10,12a-trihydroxy-12-nitroso-3,11-dioxo-7-[4-(trifluoromethyl)phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aS)-1,10,12a-trihydroxy-12-nitroso-3,11-dioxo-7-[4-(trifluoromethyl)phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 118952050 |
| Molecular Formula | C26H19F3N2O7 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | (4aS,12aS)-1,10,12a-trihydroxy-12-nitroso-3,11-dioxo-7-[4-(trifluoromethyl)phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(N=O)=C3C(=O)c4c(O)ccc(-c5ccc(C(F)(F)F)cc5)c4CC3C[C@H]2CC1=O |
| InChI | InChI=1S/C26H19F3N2O7/c27-26(28,29)12-3-1-10(2-4-12)14-5-6-16(32)19-15(14)8-11-7-13-9-17(33)20(24(30)36)23(35)25(13,37)22(31-38)18(11)21(19)34/h1-6,11,13,32,35,37H,7-9H2,(H2,30,36)/t11?,13-,25-/m0/s1 |
| InChIKey | LTMWZGRXAMFVCW-FGMKXDQUSA-N |
| XLogP | 3.47 |
| TPSA | 167.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|