C22H20ClNO6 — CID 88958154
(4aS,5aR,12aS)-7-(1-chloroethenyl)-1,10,12a-trihydroxy-12-methyl-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 88958154) has the molecular formula C22H20ClNO6 and a molecular weight of 429.86 g/mol. Its IUPAC name is (4aS,5aR,12aS)-7-(1-chloroethenyl)-1,10,12a-trihydroxy-12-methyl-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-7-(1-chloroethenyl)-1,10,12a-trihydroxy-12-methyl-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 88958154 |
| Molecular Formula | C22H20ClNO6 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | (4aS,5aR,12aS)-7-(1-chloroethenyl)-1,10,12a-trihydroxy-12-methyl-3,11-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | C=C(Cl)c1ccc(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(C)=C1C2=O |
| InChI | InChI=1S/C22H20ClNO6/c1-8-16-10(5-11-7-15(26)18(21(24)29)20(28)22(8,11)30)6-13-12(9(2)23)3-4-14(25)17(13)19(16)27/h3-4,10-11,25,28,30H,2,5-7H2,1H3,(H2,24,29)/t10-,11+,22-/m1/s1 |
| InChIKey | BMJXXKCJBULWFO-NFULHVNHSA-N |
| XLogP | 2.29 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|