C23H22O7 — CID 118083202
3-acetyl-4,6,7-trihydroxy-8-(2-oxopropyl)-1,4a,11,11a,12,12a-hexahydrotetracene-2,5-dione (PubChem CID 118083202) has the molecular formula C23H22O7 and a molecular weight of 410.42 g/mol. Its IUPAC name is 3-acetyl-4,6,7-trihydroxy-8-(2-oxopropyl)-1,4a,11,11a,12,12a-hexahydrotetracene-2,5-dione.
| Compound Name | 3-acetyl-4,6,7-trihydroxy-8-(2-oxopropyl)-1,4a,11,11a,12,12a-hexahydrotetracene-2,5-dione |
|---|---|
| PubChem CID | 118083202 |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-acetyl-4,6,7-trihydroxy-8-(2-oxopropyl)-1,4a,11,11a,12,12a-hexahydrotetracene-2,5-dione |
| SMILES | CC(=O)Cc1ccc2c(c1O)C(O)=C1C(=O)C3C(O)=C(C(C)=O)C(=O)CC3CC1C2 |
| InChI | InChI=1S/C23H22O7/c1-9(24)5-12-4-3-11-6-13-7-14-8-15(26)16(10(2)25)21(28)19(14)23(30)18(13)22(29)17(11)20(12)27/h3-4,13-14,19,27-29H,5-8H2,1-2H3 |
| InChIKey | RIKORQWMZAFUHV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|