C24H20O7 — CID 118083227
3-acetyl-10-(furan-2-yl)-4,6,7-trihydroxy-1,4a,11,11a,12,12a-hexahydrotetracene-2,5-dione (PubChem CID 118083227) has the molecular formula C24H20O7 and a molecular weight of 420.42 g/mol. Its IUPAC name is 3-acetyl-10-(furan-2-yl)-4,6,7-trihydroxy-1,4a,11,11a,12,12a-hexahydrotetracene-2,5-dione.
| Compound Name | 3-acetyl-10-(furan-2-yl)-4,6,7-trihydroxy-1,4a,11,11a,12,12a-hexahydrotetracene-2,5-dione |
|---|---|
| PubChem CID | 118083227 |
| Molecular Formula | C24H20O7 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 3-acetyl-10-(furan-2-yl)-4,6,7-trihydroxy-1,4a,11,11a,12,12a-hexahydrotetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)C2C(=O)C3=C(O)c4c(O)ccc(-c5ccco5)c4CC3CC2CC1=O |
| InChI | InChI=1S/C24H20O7/c1-10(25)18-16(27)9-12-7-11-8-14-13(17-3-2-6-31-17)4-5-15(26)21(14)24(30)19(11)23(29)20(12)22(18)28/h2-6,11-12,20,26,28,30H,7-9H2,1H3 |
| InChIKey | DMBXVQCOQIUWTK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|