C24H20N2O8 — CID 136949837
1,10,11-trihydroxy-7-[5-[(E)-hydroxyiminomethyl]furan-2-yl]-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 136949837) has the molecular formula C24H20N2O8 and a molecular weight of 464.43 g/mol. Its IUPAC name is 1,10,11-trihydroxy-7-[5-[(E)-hydroxyiminomethyl]furan-2-yl]-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 1,10,11-trihydroxy-7-[5-[(E)-hydroxyiminomethyl]furan-2-yl]-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 136949837 |
| Molecular Formula | C24H20N2O8 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 1,10,11-trihydroxy-7-[5-[(E)-hydroxyiminomethyl]furan-2-yl]-3,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2C(=O)C3=C(O)c4c(O)ccc(-c5ccc(/C=N/O)o5)c4CC3CC2CC1=O |
| InChI | InChI=1S/C24H20N2O8/c25-24(32)20-15(28)7-10-5-9-6-13-12(16-4-1-11(34-16)8-26-33)2-3-14(27)19(13)22(30)17(9)21(29)18(10)23(20)31/h1-4,8-10,18,27,30-31,33H,5-7H2,(H2,25,32)/b26-8+ |
| InChIKey | HGINKFCALZKWBB-MWRNPHMMSA-N |
| XLogP | 2.38 |
| TPSA | 183.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|