C32H29NO8 — CID 54698476
1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[5-(3-phenylpropyl)furan-2-yl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54698476) has the molecular formula C32H29NO8 and a molecular weight of 555.58 g/mol. Its IUPAC name is 1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[5-(3-phenylpropyl)furan-2-yl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[5-(3-phenylpropyl)furan-2-yl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54698476 |
| Molecular Formula | C32H29NO8 |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[5-(3-phenylpropyl)furan-2-yl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(CCCc6ccccc6)o5)c4CC3CC2CC1=O |
| InChI | InChI=1S/C32H29NO8/c33-31(39)27-23(35)15-18-13-17-14-21-20(24-12-9-19(41-24)8-4-7-16-5-2-1-3-6-16)10-11-22(34)26(21)28(36)25(17)29(37)32(18,40)30(27)38/h1-3,5-6,9-12,17-18,34,36,38,40H,4,7-8,13-15H2,(H2,33,39) |
| InChIKey | AKMSNRXXDNDFGJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|